C15H25N5O — CID 19137769
4-N-cycloheptyl-6-morpholin-4-ylpyrimidine-4,5-diamine (PubChem CID 19137769) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is 4-N-cycloheptyl-6-morpholin-4-ylpyrimidine-4,5-diamine.
| Compound Name | 4-N-cycloheptyl-6-morpholin-4-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19137769 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 4-N-cycloheptyl-6-morpholin-4-ylpyrimidine-4,5-diamine |
| SMILES | Nc1c(NC2CCCCCC2)ncnc1N1CCOCC1 |
| InChI | InChI=1S/C15H25N5O/c16-13-14(19-12-5-3-1-2-4-6-12)17-11-18-15(13)20-7-9-21-10-8-20/h11-12H,1-10,16H2,(H,17,18,19) |
| InChIKey | GBXWCIRPZRFQLA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |