C14H15Cl2N5O — CID 19137671
4-N-(2,5-dichlorophenyl)-6-morpholin-4-ylpyrimidine-4,5-diamine (PubChem CID 19137671) has the molecular formula C14H15Cl2N5O and a molecular weight of 340.21 g/mol. Its IUPAC name is 4-N-(2,5-dichlorophenyl)-6-morpholin-4-ylpyrimidine-4,5-diamine.
| Compound Name | 4-N-(2,5-dichlorophenyl)-6-morpholin-4-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19137671 |
| Molecular Formula | C14H15Cl2N5O |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 4-N-(2,5-dichlorophenyl)-6-morpholin-4-ylpyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2cc(Cl)ccc2Cl)ncnc1N1CCOCC1 |
| InChI | InChI=1S/C14H15Cl2N5O/c15-9-1-2-10(16)11(7-9)20-13-12(17)14(19-8-18-13)21-3-5-22-6-4-21/h1-2,7-8H,3-6,17H2,(H,18,19,20) |
| InChIKey | VHKKYLRGPAINCS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |