C15H19N5O2 — CID 19137683
4-N-(2-methoxyphenyl)-6-morpholin-4-ylpyrimidine-4,5-diamine (PubChem CID 19137683) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 4-N-(2-methoxyphenyl)-6-morpholin-4-ylpyrimidine-4,5-diamine.
| Compound Name | 4-N-(2-methoxyphenyl)-6-morpholin-4-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19137683 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-N-(2-methoxyphenyl)-6-morpholin-4-ylpyrimidine-4,5-diamine |
| SMILES | COc1ccccc1Nc1ncnc(N2CCOCC2)c1N |
| InChI | InChI=1S/C15H19N5O2/c1-21-12-5-3-2-4-11(12)19-14-13(16)15(18-10-17-14)20-6-8-22-9-7-20/h2-5,10H,6-9,16H2,1H3,(H,17,18,19) |
| InChIKey | BPWWEYYDHHWHDQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |