C23H28N6O2 — CID 19139028
4-N-(2-ethoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine (PubChem CID 19139028) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 4-N-(2-ethoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine.
| Compound Name | 4-N-(2-ethoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19139028 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 4-N-(2-ethoxyphenyl)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidine-4,5-diamine |
| SMILES | CCOc1ccccc1Nc1ncnc(N2CCN(c3ccc(OC)cc3)CC2)c1N |
| InChI | InChI=1S/C23H28N6O2/c1-3-31-20-7-5-4-6-19(20)27-22-21(24)23(26-16-25-22)29-14-12-28(13-15-29)17-8-10-18(30-2)11-9-17/h4-11,16H,3,12-15,24H2,1-2H3,(H,25,26,27) |
| InChIKey | QWWWURFCUBULPX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|