C22H25N5O3 — CID 19139037
4-(2-methoxyphenoxy)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-5-amine (PubChem CID 19139037) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 4-(2-methoxyphenoxy)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-5-amine.
| Compound Name | 4-(2-methoxyphenoxy)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-5-amine |
|---|---|
| PubChem CID | 19139037 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 4-(2-methoxyphenoxy)-6-[4-(4-methoxyphenyl)piperazin-1-yl]pyrimidin-5-amine |
| SMILES | COc1ccc(N2CCN(c3ncnc(Oc4ccccc4OC)c3N)CC2)cc1 |
| InChI | InChI=1S/C22H25N5O3/c1-28-17-9-7-16(8-10-17)26-11-13-27(14-12-26)21-20(23)22(25-15-24-21)30-19-6-4-3-5-18(19)29-2/h3-10,15H,11-14,23H2,1-2H3 |
| InChIKey | FLJWAYAPZAARHN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|