C20H28N6 — CID 19139366
6-(4-benzylpiperazin-1-yl)-4-N-cyclopentylpyrimidine-4,5-diamine (PubChem CID 19139366) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-4-N-cyclopentylpyrimidine-4,5-diamine.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-4-N-cyclopentylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19139366 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-4-N-cyclopentylpyrimidine-4,5-diamine |
| SMILES | Nc1c(NC2CCCC2)ncnc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N6/c21-18-19(24-17-8-4-5-9-17)22-15-23-20(18)26-12-10-25(11-13-26)14-16-6-2-1-3-7-16/h1-3,6-7,15,17H,4-5,8-14,21H2,(H,22,23,24) |
| InChIKey | DMYFXNPAPYZPDJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |