C21H22F2N6 — CID 19139365
6-(4-benzylpiperazin-1-yl)-4-N-(3,4-difluorophenyl)pyrimidine-4,5-diamine (PubChem CID 19139365) has the molecular formula C21H22F2N6 and a molecular weight of 396.45 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)-4-N-(3,4-difluorophenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(4-benzylpiperazin-1-yl)-4-N-(3,4-difluorophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19139365 |
| Molecular Formula | C21H22F2N6 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)-4-N-(3,4-difluorophenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1c(Nc2ccc(F)c(F)c2)ncnc1N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22F2N6/c22-17-7-6-16(12-18(17)23)27-20-19(24)21(26-14-25-20)29-10-8-28(9-11-29)13-15-4-2-1-3-5-15/h1-7,12,14H,8-11,13,24H2,(H,25,26,27) |
| InChIKey | HRSJJJBIIQEZEV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |