C22H26N6O2 — CID 19140732
2-[4-[5-amino-6-(4-phenoxyanilino)pyrimidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 19140732) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2-[4-[5-amino-6-(4-phenoxyanilino)pyrimidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[5-amino-6-(4-phenoxyanilino)pyrimidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 19140732 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 2-[4-[5-amino-6-(4-phenoxyanilino)pyrimidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | Nc1c(Nc2ccc(Oc3ccccc3)cc2)ncnc1N1CCN(CCO)CC1 |
| InChI | InChI=1S/C22H26N6O2/c23-20-21(24-16-25-22(20)28-12-10-27(11-13-28)14-15-29)26-17-6-8-19(9-7-17)30-18-4-2-1-3-5-18/h1-9,16,29H,10-15,23H2,(H,24,25,26) |
| InChIKey | PGSKGNRZILOVOQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |