C22H24ClN5O2 — CID 70284092
2-[4-[6-anilino-5-(4-chlorophenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol (PubChem CID 70284092) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 2-[4-[6-anilino-5-(4-chlorophenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[6-anilino-5-(4-chlorophenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 70284092 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[4-[6-anilino-5-(4-chlorophenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(c2ncnc(Nc3ccccc3)c2Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H24ClN5O2/c23-17-6-8-19(9-7-17)30-20-21(26-18-4-2-1-3-5-18)24-16-25-22(20)28-12-10-27(11-13-28)14-15-29/h1-9,16,29H,10-15H2,(H,24,25,26) |
| InChIKey | YHQXTUNPFIZMNS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |