C19H26N6O3 — CID 19140626
ethyl 4-[[5-amino-6-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]benzoate (PubChem CID 19140626) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is ethyl 4-[[5-amino-6-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-amino-6-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19140626 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | ethyl 4-[[5-amino-6-[4-(2-hydroxyethyl)piperazin-1-yl]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncnc(N3CCN(CCO)CC3)c2N)cc1 |
| InChI | InChI=1S/C19H26N6O3/c1-2-28-19(27)14-3-5-15(6-4-14)23-17-16(20)18(22-13-21-17)25-9-7-24(8-10-25)11-12-26/h3-6,13,26H,2,7-12,20H2,1H3,(H,21,22,23) |
| InChIKey | UIJMVGUTRGOCRQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |