C22H25N7O2 — CID 19146406
ethyl 4-[[5-amino-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]benzoate (PubChem CID 19146406) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is ethyl 4-[[5-amino-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-amino-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19146406 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | ethyl 4-[[5-amino-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncnc(N3CCN(c4ccccn4)CC3)c2N)cc1 |
| InChI | InChI=1S/C22H25N7O2/c1-2-31-22(30)16-6-8-17(9-7-16)27-20-19(23)21(26-15-25-20)29-13-11-28(12-14-29)18-5-3-4-10-24-18/h3-10,15H,2,11-14,23H2,1H3,(H,25,26,27) |
| InChIKey | VLWQZOLOYRZZCO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |