C18H25N7O2 — CID 19144025
ethyl 4-[[5-amino-6-[(4-methylpiperazin-1-yl)amino]pyrimidin-4-yl]amino]benzoate (PubChem CID 19144025) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is ethyl 4-[[5-amino-6-[(4-methylpiperazin-1-yl)amino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-amino-6-[(4-methylpiperazin-1-yl)amino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19144025 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | ethyl 4-[[5-amino-6-[(4-methylpiperazin-1-yl)amino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncnc(NN3CCN(C)CC3)c2N)cc1 |
| InChI | InChI=1S/C18H25N7O2/c1-3-27-18(26)13-4-6-14(7-5-13)22-16-15(19)17(21-12-20-16)23-25-10-8-24(2)9-11-25/h4-7,12H,3,8-11,19H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | MCXSSSUFUJPYTR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |