C20H18F3N5O2 — CID 22545595
ethyl 4-[[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate (PubChem CID 22545595) has the molecular formula C20H18F3N5O2 and a molecular weight of 417.39 g/mol. Its IUPAC name is ethyl 4-[[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 4-[[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22545595 |
| Molecular Formula | C20H18F3N5O2 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | ethyl 4-[[5-amino-6-[2-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2ncnc(Nc3ccccc3C(F)(F)F)c2N)cc1 |
| InChI | InChI=1S/C20H18F3N5O2/c1-2-30-19(29)12-7-9-13(10-8-12)27-17-16(24)18(26-11-25-17)28-15-6-4-3-5-14(15)20(21,22)23/h3-11H,2,24H2,1H3,(H2,25,26,27,28) |
| InChIKey | JTWDUFIWWPNVCU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |