C22H22F3N5O2 — CID 19149560
2-methylpropyl 4-[[5-amino-6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate (PubChem CID 19149560) has the molecular formula C22H22F3N5O2 and a molecular weight of 445.45 g/mol. Its IUPAC name is 2-methylpropyl 4-[[5-amino-6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[5-amino-6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19149560 |
| Molecular Formula | C22H22F3N5O2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-methylpropyl 4-[[5-amino-6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(Nc2ncnc(Nc3ccc(C(F)(F)F)cc3)c2N)cc1 |
| InChI | InChI=1S/C22H22F3N5O2/c1-13(2)11-32-21(31)14-3-7-16(8-4-14)29-19-18(26)20(28-12-27-19)30-17-9-5-15(6-10-17)22(23,24)25/h3-10,12-13H,11,26H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | NNTPLORMFDGQKU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |