C27H29N5O2 — CID 22545832
2-methylpropyl 4-[[5-amino-6-[ethyl(naphthalen-1-yl)amino]pyrimidin-4-yl]amino]benzoate (PubChem CID 22545832) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-methylpropyl 4-[[5-amino-6-[ethyl(naphthalen-1-yl)amino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[5-amino-6-[ethyl(naphthalen-1-yl)amino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22545832 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 2-methylpropyl 4-[[5-amino-6-[ethyl(naphthalen-1-yl)amino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCN(c1ncnc(Nc2ccc(C(=O)OCC(C)C)cc2)c1N)c1cccc2ccccc12 |
| InChI | InChI=1S/C27H29N5O2/c1-4-32(23-11-7-9-19-8-5-6-10-22(19)23)26-24(28)25(29-17-30-26)31-21-14-12-20(13-15-21)27(33)34-16-18(2)3/h5-15,17-18H,4,16,28H2,1-3H3,(H,29,30,31) |
| InChIKey | OGNTUALZOWIYRN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |