C22H24ClN5O3 — CID 22546040
2-methylpropyl 4-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 22546040) has the molecular formula C22H24ClN5O3 and a molecular weight of 441.92 g/mol. Its IUPAC name is 2-methylpropyl 4-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22546040 |
| Molecular Formula | C22H24ClN5O3 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-methylpropyl 4-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | COc1ccc(Cl)cc1Nc1ncnc(Nc2ccc(C(=O)OCC(C)C)cc2)c1N |
| InChI | InChI=1S/C22H24ClN5O3/c1-13(2)11-31-22(29)14-4-7-16(8-5-14)27-20-19(24)21(26-12-25-20)28-17-10-15(23)6-9-18(17)30-3/h4-10,12-13H,11,24H2,1-3H3,(H2,25,26,27,28) |
| InChIKey | XMQCDVDVPSOJPE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |