C17H14F3N5 — CID 22545606
6-N-phenyl-4-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,5,6-triamine (PubChem CID 22545606) has the molecular formula C17H14F3N5 and a molecular weight of 345.33 g/mol. Its IUPAC name is 6-N-phenyl-4-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-phenyl-4-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22545606 |
| Molecular Formula | C17H14F3N5 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 6-N-phenyl-4-N-[2-(trifluoromethyl)phenyl]pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccccc2)ncnc1Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H14F3N5/c18-17(19,20)12-8-4-5-9-13(12)25-16-14(21)15(22-10-23-16)24-11-6-2-1-3-7-11/h1-10H,21H2,(H2,22,23,24,25) |
| InChIKey | SQSSUUZJCMBSOW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |