C19H19N5O3 — CID 19149280
4-[[5-amino-6-(4-ethoxyanilino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 19149280) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 4-[[5-amino-6-(4-ethoxyanilino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[5-amino-6-(4-ethoxyanilino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 19149280 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 4-[[5-amino-6-(4-ethoxyanilino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | CCOc1ccc(Nc2ncnc(Nc3ccc(C(=O)O)cc3)c2N)cc1 |
| InChI | InChI=1S/C19H19N5O3/c1-2-27-15-9-7-14(8-10-15)24-18-16(20)17(21-11-22-18)23-13-5-3-12(4-6-13)19(25)26/h3-11H,2,20H2,1H3,(H,25,26)(H2,21,22,23,24) |
| InChIKey | YXQLZJUJUPVUQI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |