C18H18ClN5O — CID 19148675
4-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19148675) has the molecular formula C18H18ClN5O and a molecular weight of 355.83 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19148675 |
| Molecular Formula | C18H18ClN5O |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCOc1ccc(Nc2ncnc(Nc3ccc(Cl)cc3)c2N)cc1 |
| InChI | InChI=1S/C18H18ClN5O/c1-2-25-15-9-7-14(8-10-15)24-18-16(20)17(21-11-22-18)23-13-5-3-12(19)4-6-13/h3-11H,2,20H2,1H3,(H2,21,22,23,24) |
| InChIKey | UIXBBQKTRWMJGB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |