C12H14ClN5 — CID 19135249
4-N-(4-chlorophenyl)-6-N-ethylpyrimidine-4,5,6-triamine (PubChem CID 19135249) has the molecular formula C12H14ClN5 and a molecular weight of 263.73 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-6-N-ethylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(4-chlorophenyl)-6-N-ethylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19135249 |
| Molecular Formula | C12H14ClN5 |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 4-N-(4-chlorophenyl)-6-N-ethylpyrimidine-4,5,6-triamine |
| SMILES | CCNc1ncnc(Nc2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C12H14ClN5/c1-2-15-11-10(14)12(17-7-16-11)18-9-5-3-8(13)4-6-9/h3-7H,2,14H2,1H3,(H2,15,16,17,18) |
| InChIKey | ZKTZUJYDZFUYNS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |