C8H17N5 — CID 142869068
ethane;4-N-ethylpyrimidine-4,5,6-triamine (PubChem CID 142869068) has the molecular formula C8H17N5 and a molecular weight of 183.26 g/mol. Its IUPAC name is ethane;4-N-ethylpyrimidine-4,5,6-triamine.
| Compound Name | ethane;4-N-ethylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 142869068 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | ethane;4-N-ethylpyrimidine-4,5,6-triamine |
| SMILES | CC.CCNc1ncnc(N)c1N |
| InChI | InChI=1S/C6H11N5.C2H6/c1-2-9-6-4(7)5(8)10-3-11-6;1-2/h3H,2,7H2,1H3,(H3,8,9,10,11);1-2H3 |
| InChIKey | UDMIDRDHFABWQJ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |