C9H16N4 — CID 80770662
4-N-ethyl-5-propan-2-ylpyrimidine-4,6-diamine (PubChem CID 80770662) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-N-ethyl-5-propan-2-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-ethyl-5-propan-2-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80770662 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4-N-ethyl-5-propan-2-ylpyrimidine-4,6-diamine |
| SMILES | CCNc1ncnc(N)c1C(C)C |
| InChI | InChI=1S/C9H16N4/c1-4-11-9-7(6(2)3)8(10)12-5-13-9/h5-6H,4H2,1-3H3,(H3,10,11,12,13) |
| InChIKey | MKUZEELADQKUDF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |