C9H12N6S — CID 19135239
6-N-ethyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5,6-triamine (PubChem CID 19135239) has the molecular formula C9H12N6S and a molecular weight of 236.30 g/mol. Its IUPAC name is 6-N-ethyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-ethyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19135239 |
| Molecular Formula | C9H12N6S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 6-N-ethyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5,6-triamine |
| SMILES | CCNc1ncnc(Nc2nccs2)c1N |
| InChI | InChI=1S/C9H12N6S/c1-2-11-7-6(10)8(14-5-13-7)15-9-12-3-4-16-9/h3-5H,2,10H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | YJQSOCUKVOVWTO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |