C11H16N6S — CID 19134848
6-N-butyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5,6-triamine (PubChem CID 19134848) has the molecular formula C11H16N6S and a molecular weight of 264.36 g/mol. Its IUPAC name is 6-N-butyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-butyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19134848 |
| Molecular Formula | C11H16N6S |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-N-butyl-4-N-(1,3-thiazol-2-yl)pyrimidine-4,5,6-triamine |
| SMILES | CCCCNc1ncnc(Nc2nccs2)c1N |
| InChI | InChI=1S/C11H16N6S/c1-2-3-4-13-9-8(12)10(16-7-15-9)17-11-14-5-6-18-11/h5-7H,2-4,12H2,1H3,(H2,13,14,15,16,17) |
| InChIKey | OXHOLHVMLDTTRI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|