C18H27N5 — CID 22539974
6-N-butyl-4-N-(4-butylphenyl)pyrimidine-4,5,6-triamine (PubChem CID 22539974) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 6-N-butyl-4-N-(4-butylphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-butyl-4-N-(4-butylphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22539974 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 6-N-butyl-4-N-(4-butylphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCCCNc1ncnc(Nc2ccc(CCCC)cc2)c1N |
| InChI | InChI=1S/C18H27N5/c1-3-5-7-14-8-10-15(11-9-14)23-18-16(19)17(21-13-22-18)20-12-6-4-2/h8-11,13H,3-7,12,19H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | WYAMVALUDRQLBU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|