C14H18N4O — CID 135709693
5-amino-4-(4-butylanilino)-1H-pyrimidin-6-one (PubChem CID 135709693) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-amino-4-(4-butylanilino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(4-butylanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135709693 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 5-amino-4-(4-butylanilino)-1H-pyrimidin-6-one |
| SMILES | CCCCc1ccc(Nc2nc[nH]c(=O)c2N)cc1 |
| InChI | InChI=1S/C14H18N4O/c1-2-3-4-10-5-7-11(8-6-10)18-13-12(15)14(19)17-9-16-13/h5-9H,2-4,15H2,1H3,(H2,16,17,18,19) |
| InChIKey | CNARXTWKBCKIJS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |