C10H19N5 — CID 19135168
4-N,4-N,6-N-triethylpyrimidine-4,5,6-triamine (PubChem CID 19135168) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 4-N,4-N,6-N-triethylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N,4-N,6-N-triethylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19135168 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 4-N,4-N,6-N-triethylpyrimidine-4,5,6-triamine |
| SMILES | CCNc1ncnc(N(CC)CC)c1N |
| InChI | InChI=1S/C10H19N5/c1-4-12-9-8(11)10(14-7-13-9)15(5-2)6-3/h7H,4-6,11H2,1-3H3,(H,12,13,14) |
| InChIKey | FNOXQXMQHXMDGD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |