C12H24N6O — CID 19141187
2-[[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]-ethylamino]ethanol (PubChem CID 19141187) has the molecular formula C12H24N6O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-[[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]-ethylamino]ethanol.
| Compound Name | 2-[[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]-ethylamino]ethanol |
|---|---|
| PubChem CID | 19141187 |
| Molecular Formula | C12H24N6O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 2-[[5-amino-6-(2-tert-butylhydrazinyl)pyrimidin-4-yl]-ethylamino]ethanol |
| SMILES | CCN(CCO)c1ncnc(NNC(C)(C)C)c1N |
| InChI | InChI=1S/C12H24N6O/c1-5-18(6-7-19)11-9(13)10(14-8-15-11)16-17-12(2,3)4/h8,17,19H,5-7,13H2,1-4H3,(H,14,15,16) |
| InChIKey | UMYIEOVHZUFZHO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|