C15H20N4O3 — CID 19141235
2-[[5-amino-6-(4-methoxyphenoxy)pyrimidin-4-yl]-ethylamino]ethanol (PubChem CID 19141235) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[[5-amino-6-(4-methoxyphenoxy)pyrimidin-4-yl]-ethylamino]ethanol.
| Compound Name | 2-[[5-amino-6-(4-methoxyphenoxy)pyrimidin-4-yl]-ethylamino]ethanol |
|---|---|
| PubChem CID | 19141235 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-[[5-amino-6-(4-methoxyphenoxy)pyrimidin-4-yl]-ethylamino]ethanol |
| SMILES | CCN(CCO)c1ncnc(Oc2ccc(OC)cc2)c1N |
| InChI | InChI=1S/C15H20N4O3/c1-3-19(8-9-20)14-13(16)15(18-10-17-14)22-12-6-4-11(21-2)5-7-12/h4-7,10,20H,3,8-9,16H2,1-2H3 |
| InChIKey | DWKPUPIEVYKGRV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |