C19H19N3O3 — CID 22540861
4-(3,5-dimethylphenoxy)-6-(4-methoxyphenoxy)pyrimidin-5-amine (PubChem CID 22540861) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-(3,5-dimethylphenoxy)-6-(4-methoxyphenoxy)pyrimidin-5-amine.
| Compound Name | 4-(3,5-dimethylphenoxy)-6-(4-methoxyphenoxy)pyrimidin-5-amine |
|---|---|
| PubChem CID | 22540861 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-(3,5-dimethylphenoxy)-6-(4-methoxyphenoxy)pyrimidin-5-amine |
| SMILES | COc1ccc(Oc2ncnc(Oc3cc(C)cc(C)c3)c2N)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-12-8-13(2)10-16(9-12)25-19-17(20)18(21-11-22-19)24-15-6-4-14(23-3)5-7-15/h4-11H,20H2,1-3H3 |
| InChIKey | RQGXBGVMRZCPFA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |