C16H23N5O — CID 22540813
4-(2-tert-butylhydrazinyl)-6-(3,5-dimethylphenoxy)pyrimidin-5-amine (PubChem CID 22540813) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-(2-tert-butylhydrazinyl)-6-(3,5-dimethylphenoxy)pyrimidin-5-amine.
| Compound Name | 4-(2-tert-butylhydrazinyl)-6-(3,5-dimethylphenoxy)pyrimidin-5-amine |
|---|---|
| PubChem CID | 22540813 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 4-(2-tert-butylhydrazinyl)-6-(3,5-dimethylphenoxy)pyrimidin-5-amine |
| SMILES | Cc1cc(C)cc(Oc2ncnc(NNC(C)(C)C)c2N)c1 |
| InChI | InChI=1S/C16H23N5O/c1-10-6-11(2)8-12(7-10)22-15-13(17)14(18-9-19-15)20-21-16(3,4)5/h6-9,21H,17H2,1-5H3,(H,18,19,20) |
| InChIKey | JHKZBIUKCUZEAW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|