C15H22N6O — CID 22543956
6-(2-tert-butylhydrazinyl)-4-N-(3-methoxyphenyl)pyrimidine-4,5-diamine (PubChem CID 22543956) has the molecular formula C15H22N6O and a molecular weight of 302.38 g/mol. Its IUPAC name is 6-(2-tert-butylhydrazinyl)-4-N-(3-methoxyphenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(2-tert-butylhydrazinyl)-4-N-(3-methoxyphenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22543956 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 6-(2-tert-butylhydrazinyl)-4-N-(3-methoxyphenyl)pyrimidine-4,5-diamine |
| SMILES | COc1cccc(Nc2ncnc(NNC(C)(C)C)c2N)c1 |
| InChI | InChI=1S/C15H22N6O/c1-15(2,3)21-20-14-12(16)13(17-9-18-14)19-10-6-5-7-11(8-10)22-4/h5-9,21H,16H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | JSBNHZUEQRBQIS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|