C19H21N5O2 — CID 22543912
6-N-(4-ethoxyphenyl)-4-N-(3-methoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 22543912) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-N-(4-ethoxyphenyl)-4-N-(3-methoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(4-ethoxyphenyl)-4-N-(3-methoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22543912 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 6-N-(4-ethoxyphenyl)-4-N-(3-methoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCOc1ccc(Nc2ncnc(Nc3cccc(OC)c3)c2N)cc1 |
| InChI | InChI=1S/C19H21N5O2/c1-3-26-15-9-7-13(8-10-15)23-18-17(20)19(22-12-21-18)24-14-5-4-6-16(11-14)25-2/h4-12H,3,20H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | ZAXYKRPPXIZZSO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |