C14H18F2N6 — CID 19152757
6-(2-tert-butylhydrazinyl)-4-N-(3,4-difluorophenyl)pyrimidine-4,5-diamine (PubChem CID 19152757) has the molecular formula C14H18F2N6 and a molecular weight of 308.34 g/mol. Its IUPAC name is 6-(2-tert-butylhydrazinyl)-4-N-(3,4-difluorophenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(2-tert-butylhydrazinyl)-4-N-(3,4-difluorophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19152757 |
| Molecular Formula | C14H18F2N6 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 6-(2-tert-butylhydrazinyl)-4-N-(3,4-difluorophenyl)pyrimidine-4,5-diamine |
| SMILES | CC(C)(C)NNc1ncnc(Nc2ccc(F)c(F)c2)c1N |
| InChI | InChI=1S/C14H18F2N6/c1-14(2,3)22-21-13-11(17)12(18-7-19-13)20-8-4-5-9(15)10(16)6-8/h4-7,22H,17H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | VEXVCOUKKPSNCS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|