C15H20N6O2 — CID 22542184
4-N-(1,3-benzodioxol-5-yl)-6-(2-tert-butylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 22542184) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-6-(2-tert-butylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-6-(2-tert-butylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22542184 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-6-(2-tert-butylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | CC(C)(C)NNc1ncnc(Nc2ccc3c(c2)OCO3)c1N |
| InChI | InChI=1S/C15H20N6O2/c1-15(2,3)21-20-14-12(16)13(17-7-18-14)19-9-4-5-10-11(6-9)23-8-22-10/h4-7,21H,8,16H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | CTCOZLQINCMUCV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|