C18H15FN6O3 — CID 22542161
N'-[5-amino-6-(1,3-benzodioxol-5-ylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide (PubChem CID 22542161) has the molecular formula C18H15FN6O3 and a molecular weight of 382.36 g/mol. Its IUPAC name is N'-[5-amino-6-(1,3-benzodioxol-5-ylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(1,3-benzodioxol-5-ylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 22542161 |
| Molecular Formula | C18H15FN6O3 |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N'-[5-amino-6-(1,3-benzodioxol-5-ylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccc(F)cc2)ncnc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H15FN6O3/c19-11-3-1-10(2-4-11)18(26)25-24-17-15(20)16(21-8-22-17)23-12-5-6-13-14(7-12)28-9-27-13/h1-8H,9,20H2,(H,25,26)(H2,21,22,23,24) |
| InChIKey | MEYYCQXKSPNIIB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|