C11H9ClFN5O — CID 23477568
N'-(5-amino-6-chloropyrimidin-4-yl)-4-fluorobenzohydrazide (PubChem CID 23477568) has the molecular formula C11H9ClFN5O and a molecular weight of 281.68 g/mol. Its IUPAC name is N'-(5-amino-6-chloropyrimidin-4-yl)-4-fluorobenzohydrazide.
| Compound Name | N'-(5-amino-6-chloropyrimidin-4-yl)-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 23477568 |
| Molecular Formula | C11H9ClFN5O |
| Molecular Weight | 281.68 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | N'-(5-amino-6-chloropyrimidin-4-yl)-4-fluorobenzohydrazide |
| SMILES | Nc1c(Cl)ncnc1NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H9ClFN5O/c12-9-8(14)10(16-5-15-9)17-18-11(19)6-1-3-7(13)4-2-6/h1-5H,14H2,(H,18,19)(H,15,16,17) |
| InChIKey | YFJIYSSZWLVWFO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.68 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|