C17H21FN6O — CID 19135857
N'-[5-amino-6-(cyclohexylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide (PubChem CID 19135857) has the molecular formula C17H21FN6O and a molecular weight of 344.39 g/mol. Its IUPAC name is N'-[5-amino-6-(cyclohexylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(cyclohexylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 19135857 |
| Molecular Formula | C17H21FN6O |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N'-[5-amino-6-(cyclohexylamino)pyrimidin-4-yl]-4-fluorobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccc(F)cc2)ncnc1NC1CCCCC1 |
| InChI | InChI=1S/C17H21FN6O/c18-12-8-6-11(7-9-12)17(25)24-23-16-14(19)15(20-10-21-16)22-13-4-2-1-3-5-13/h6-10,13H,1-5,19H2,(H,24,25)(H2,20,21,22,23) |
| InChIKey | QCNWPYGLKYNPQI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|