C18H23FN6O — CID 19140506
N'-[5-amino-6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]-4-fluorobenzohydrazide (PubChem CID 19140506) has the molecular formula C18H23FN6O and a molecular weight of 358.42 g/mol. Its IUPAC name is N'-[5-amino-6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]-4-fluorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 19140506 |
| Molecular Formula | C18H23FN6O |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N'-[5-amino-6-(2-ethylpiperidin-1-yl)pyrimidin-4-yl]-4-fluorobenzohydrazide |
| SMILES | CCC1CCCCN1c1ncnc(NNC(=O)c2ccc(F)cc2)c1N |
| InChI | InChI=1S/C18H23FN6O/c1-2-14-5-3-4-10-25(14)17-15(20)16(21-11-22-17)23-24-18(26)12-6-8-13(19)9-7-12/h6-9,11,14H,2-5,10,20H2,1H3,(H,24,26)(H,21,22,23) |
| InChIKey | MNASXGNGPFFVIX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|