C23H28BrN7O — CID 24984065
N'-(5-bromo-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(4-methylpiperazin-1-yl)methyl]benzohydrazide (PubChem CID 24984065) has the molecular formula C23H28BrN7O and a molecular weight of 498.43 g/mol. Its IUPAC name is N'-(5-bromo-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(4-methylpiperazin-1-yl)methyl]benzohydrazide.
| Compound Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(4-methylpiperazin-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 24984065 |
| Molecular Formula | C23H28BrN7O |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(4-methylpiperazin-1-yl)methyl]benzohydrazide |
| SMILES | CN1CCN(Cc2ccc(C(=O)NN(c3nc(C#N)ncc3Br)C3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C23H28BrN7O/c1-29-10-12-30(13-11-29)16-17-6-8-18(9-7-17)23(32)28-31(19-4-2-3-5-19)22-20(24)15-26-21(14-25)27-22/h6-9,15,19H,2-5,10-13,16H2,1H3,(H,28,32) |
| InChIKey | BWMLNSQFLSCDFW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|