C23H28BrN7O2 — CID 24985370
N'-(5-bromo-2-cyanopyrimidin-4-yl)-4-[(4-methylpiperazin-1-yl)methyl]-N'-(oxan-4-yl)benzohydrazide (PubChem CID 24985370) has the molecular formula C23H28BrN7O2 and a molecular weight of 514.43 g/mol. Its IUPAC name is N'-(5-bromo-2-cyanopyrimidin-4-yl)-4-[(4-methylpiperazin-1-yl)methyl]-N'-(oxan-4-yl)benzohydrazide.
| Compound Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-4-[(4-methylpiperazin-1-yl)methyl]-N'-(oxan-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 24985370 |
| Molecular Formula | C23H28BrN7O2 |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | N'-(5-bromo-2-cyanopyrimidin-4-yl)-4-[(4-methylpiperazin-1-yl)methyl]-N'-(oxan-4-yl)benzohydrazide |
| SMILES | CN1CCN(Cc2ccc(C(=O)NN(c3nc(C#N)ncc3Br)C3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C23H28BrN7O2/c1-29-8-10-30(11-9-29)16-17-2-4-18(5-3-17)23(32)28-31(19-6-12-33-13-7-19)22-20(24)15-26-21(14-25)27-22/h2-5,15,19H,6-13,16H2,1H3,(H,28,32) |
| InChIKey | OYUPEYJGGPSRJI-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|