C23H27ClN6O2 — CID 24983596
N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(4-hydroxypiperidin-1-yl)methyl]benzohydrazide (PubChem CID 24983596) has the molecular formula C23H27ClN6O2 and a molecular weight of 454.96 g/mol. Its IUPAC name is N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(4-hydroxypiperidin-1-yl)methyl]benzohydrazide.
| Compound Name | N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(4-hydroxypiperidin-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 24983596 |
| Molecular Formula | C23H27ClN6O2 |
| Molecular Weight | 454.96 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(4-hydroxypiperidin-1-yl)methyl]benzohydrazide |
| SMILES | N#Cc1ncc(Cl)c(N(NC(=O)c2ccc(CN3CCC(O)CC3)cc2)C2CCCC2)n1 |
| InChI | InChI=1S/C23H27ClN6O2/c24-20-14-26-21(13-25)27-22(20)30(18-3-1-2-4-18)28-23(32)17-7-5-16(6-8-17)15-29-11-9-19(31)10-12-29/h5-8,14,18-19,31H,1-4,9-12,15H2,(H,28,32) |
| InChIKey | HQOUMFNLOVAZAH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.96 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|