C27H34ClF3N6O3 — CID 68839927
N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(heptylamino)methyl]benzohydrazide;2,2,2-trifluoroacetic acid (PubChem CID 68839927) has the molecular formula C27H34ClF3N6O3 and a molecular weight of 583.06 g/mol. Its IUPAC name is N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(heptylamino)methyl]benzohydrazide;2,2,2-trifluoroacetic acid.
| Compound Name | N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(heptylamino)methyl]benzohydrazide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68839927 |
| Molecular Formula | C27H34ClF3N6O3 |
| Molecular Weight | 583.06 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-cyclopentyl-4-[(heptylamino)methyl]benzohydrazide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCNCc1ccc(C(=O)NN(c2nc(C#N)ncc2Cl)C2CCCC2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H33ClN6O.C2HF3O2/c1-2-3-4-5-8-15-28-17-19-11-13-20(14-12-19)25(33)31-32(21-9-6-7-10-21)24-22(26)18-29-23(16-27)30-24;3-2(4,5)1(6)7/h11-14,18,21,28H,2-10,15,17H2,1H3,(H,31,33);(H,6,7) |
| InChIKey | ACYCJDBJARTFHZ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.06 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|