C23H33ClN6O — CID 70300629
N'-(2-amino-5-chloropyrimidin-4-yl)-N'-cyclopentyl-4-[[di(propan-2-yl)amino]methyl]benzohydrazide (PubChem CID 70300629) has the molecular formula C23H33ClN6O and a molecular weight of 445.01 g/mol. Its IUPAC name is N'-(2-amino-5-chloropyrimidin-4-yl)-N'-cyclopentyl-4-[[di(propan-2-yl)amino]methyl]benzohydrazide.
| Compound Name | N'-(2-amino-5-chloropyrimidin-4-yl)-N'-cyclopentyl-4-[[di(propan-2-yl)amino]methyl]benzohydrazide |
|---|---|
| PubChem CID | 70300629 |
| Molecular Formula | C23H33ClN6O |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | N'-(2-amino-5-chloropyrimidin-4-yl)-N'-cyclopentyl-4-[[di(propan-2-yl)amino]methyl]benzohydrazide |
| SMILES | CC(C)N(Cc1ccc(C(=O)NN(c2nc(N)ncc2Cl)C2CCCC2)cc1)C(C)C |
| InChI | InChI=1S/C23H33ClN6O/c1-15(2)29(16(3)4)14-17-9-11-18(12-10-17)22(31)28-30(19-7-5-6-8-19)21-20(24)13-26-23(25)27-21/h9-13,15-16,19H,5-8,14H2,1-4H3,(H,28,31)(H2,25,26,27) |
| InChIKey | MQWQJRJWJKSWTE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|