C21H26N6O3 — CID 143419540
N'-(2-cyano-5-hydroxypyrimidin-4-yl)-4-[(3-hydroxypyrrolidin-1-yl)methyl]-N'-(2-methylpropyl)benzohydrazide (PubChem CID 143419540) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is N'-(2-cyano-5-hydroxypyrimidin-4-yl)-4-[(3-hydroxypyrrolidin-1-yl)methyl]-N'-(2-methylpropyl)benzohydrazide.
| Compound Name | N'-(2-cyano-5-hydroxypyrimidin-4-yl)-4-[(3-hydroxypyrrolidin-1-yl)methyl]-N'-(2-methylpropyl)benzohydrazide |
|---|---|
| PubChem CID | 143419540 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N'-(2-cyano-5-hydroxypyrimidin-4-yl)-4-[(3-hydroxypyrrolidin-1-yl)methyl]-N'-(2-methylpropyl)benzohydrazide |
| SMILES | CC(C)CN(NC(=O)c1ccc(CN2CCC(O)C2)cc1)c1nc(C#N)ncc1O |
| InChI | InChI=1S/C21H26N6O3/c1-14(2)11-27(20-18(29)10-23-19(9-22)24-20)25-21(30)16-5-3-15(4-6-16)12-26-8-7-17(28)13-26/h3-6,10,14,17,28-29H,7-8,11-13H2,1-2H3,(H,25,30) |
| InChIKey | SKPJEHZYYMJVOC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 125.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|