C24H33N7O2 — CID 143419560
N'-(2-cyano-5-hydroxypyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-4-(4-propylpiperazin-1-yl)benzohydrazide (PubChem CID 143419560) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is N'-(2-cyano-5-hydroxypyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-4-(4-propylpiperazin-1-yl)benzohydrazide.
| Compound Name | N'-(2-cyano-5-hydroxypyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-4-(4-propylpiperazin-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 143419560 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | N'-(2-cyano-5-hydroxypyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-4-(4-propylpiperazin-1-yl)benzohydrazide |
| SMILES | CCCN1CCN(c2ccc(C(=O)NN(CC(C)(C)C)c3nc(C#N)ncc3O)cc2)CC1 |
| InChI | InChI=1S/C24H33N7O2/c1-5-10-29-11-13-30(14-12-29)19-8-6-18(7-9-19)23(33)28-31(17-24(2,3)4)22-20(32)16-26-21(15-25)27-22/h6-9,16,32H,5,10-14,17H2,1-4H3,(H,28,33) |
| InChIKey | KAERUSLIXJHDKN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|