C26H37N7O2 — CID 11619941
N-[[2-cyano-4-(2,2-dimethylpropylamino)pyrimidin-5-yl]methyl]-4-[4-(2-ethoxyethyl)piperazin-1-yl]benzamide (PubChem CID 11619941) has the molecular formula C26H37N7O2 and a molecular weight of 479.63 g/mol. Its IUPAC name is N-[[2-cyano-4-(2,2-dimethylpropylamino)pyrimidin-5-yl]methyl]-4-[4-(2-ethoxyethyl)piperazin-1-yl]benzamide.
| Compound Name | N-[[2-cyano-4-(2,2-dimethylpropylamino)pyrimidin-5-yl]methyl]-4-[4-(2-ethoxyethyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 11619941 |
| Molecular Formula | C26H37N7O2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | N-[[2-cyano-4-(2,2-dimethylpropylamino)pyrimidin-5-yl]methyl]-4-[4-(2-ethoxyethyl)piperazin-1-yl]benzamide |
| SMILES | CCOCCN1CCN(c2ccc(C(=O)NCc3cnc(C#N)nc3NCC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C26H37N7O2/c1-5-35-15-14-32-10-12-33(13-11-32)22-8-6-20(7-9-22)25(34)29-18-21-17-28-23(16-27)31-24(21)30-19-26(2,3)4/h6-9,17H,5,10-15,18-19H2,1-4H3,(H,29,34)(H,28,30,31) |
| InChIKey | OPIQYRAOAKVXFN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|