C19H33N3O — CID 155109476
N-[[4-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 155109476) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is N-[[4-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[4-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 155109476 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | N-[[4-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CCOCCN1CCN(c2ccc(CNC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H33N3O/c1-5-23-15-14-21-10-12-22(13-11-21)18-8-6-17(7-9-18)16-20-19(2,3)4/h6-9,20H,5,10-16H2,1-4H3 |
| InChIKey | GYOQJOKKBADSGS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|