C19H30N2O2 — CID 87693965
3-[3-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]-2,2-dimethylpropanal (PubChem CID 87693965) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 3-[3-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]-2,2-dimethylpropanal.
| Compound Name | 3-[3-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 87693965 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 3-[3-[4-(2-ethoxyethyl)piperazin-1-yl]phenyl]-2,2-dimethylpropanal |
| SMILES | CCOCCN1CCN(c2cccc(CC(C)(C)C=O)c2)CC1 |
| InChI | InChI=1S/C19H30N2O2/c1-4-23-13-12-20-8-10-21(11-9-20)18-7-5-6-17(14-18)15-19(2,3)16-22/h5-7,14,16H,4,8-13,15H2,1-3H3 |
| InChIKey | MZTUCOQRRPKCOR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|