C25H30F6N4O — CID 3051828
1-[3-(trifluoromethyl)phenyl]-4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxymethyl]piperazine (PubChem CID 3051828) has the molecular formula C25H30F6N4O and a molecular weight of 516.53 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxymethyl]piperazine.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxymethyl]piperazine |
|---|---|
| PubChem CID | 3051828 |
| Molecular Formula | C25H30F6N4O |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethoxymethyl]piperazine |
| SMILES | FC(F)(F)c1cccc(N2CCN(CCOCN3CCN(c4cccc(C(F)(F)F)c4)CC3)CC2)c1 |
| InChI | InChI=1S/C25H30F6N4O/c26-24(27,28)20-3-1-5-22(17-20)34-11-7-32(8-12-34)15-16-36-19-33-9-13-35(14-10-33)23-6-2-4-21(18-23)25(29,30)31/h1-6,17-18H,7-16,19H2 |
| InChIKey | LUUWIZSKHJYRGF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|